C18H22ClNO3 — CID 54551967
N-[(2S)-4-chloro-3,5-dioxo-1-phenylpentan-2-yl]cyclohexanecarboxamide (PubChem CID 54551967) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is N-[(2S)-4-chloro-3,5-dioxo-1-phenylpentan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-4-chloro-3,5-dioxo-1-phenylpentan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 54551967 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[(2S)-4-chloro-3,5-dioxo-1-phenylpentan-2-yl]cyclohexanecarboxamide |
| SMILES | O=CC(Cl)C(=O)[C@H](Cc1ccccc1)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H22ClNO3/c19-15(12-21)17(22)16(11-13-7-3-1-4-8-13)20-18(23)14-9-5-2-6-10-14/h1,3-4,7-8,12,14-16H,2,5-6,9-11H2,(H,20,23)/t15?,16-/m0/s1 |
| InChIKey | ZKNIFUQQQORWJK-LYKKTTPLSA-N |
| XLogP | 2.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|