C21H31N3O2 — CID 156607431
N-(1-amino-1-oxo-3-phenylpropan-2-yl)-1-cyclohexylpiperidine-4-carboxamide (PubChem CID 156607431) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-(1-amino-1-oxo-3-phenylpropan-2-yl)-1-cyclohexylpiperidine-4-carboxamide.
| Compound Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-1-cyclohexylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 156607431 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-1-cyclohexylpiperidine-4-carboxamide |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)C1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H31N3O2/c22-20(25)19(15-16-7-3-1-4-8-16)23-21(26)17-11-13-24(14-12-17)18-9-5-2-6-10-18/h1,3-4,7-8,17-19H,2,5-6,9-15H2,(H2,22,25)(H,23,26) |
| InChIKey | YLSJPEKUYWIACH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |