C20H29N3O4 — CID 48735739
tert-butyl 4-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 48735739) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl 4-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 48735739 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl 4-[(1-amino-1-oxo-3-phenylpropan-2-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NC(Cc2ccccc2)C(N)=O)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-20(2,3)27-19(26)23-11-9-15(10-12-23)18(25)22-16(17(21)24)13-14-7-5-4-6-8-14/h4-8,15-16H,9-13H2,1-3H3,(H2,21,24)(H,22,25) |
| InChIKey | BLUSASRBEFLUBS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |