C21H25N3O3S — CID 88587408
(2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(3-hydroxyphenyl)sulfanylpiperidine-2-carboxamide (PubChem CID 88587408) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(3-hydroxyphenyl)sulfanylpiperidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(3-hydroxyphenyl)sulfanylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 88587408 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-1-(3-hydroxyphenyl)sulfanylpiperidine-2-carboxamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCCN1Sc1cccc(O)c1 |
| InChI | InChI=1S/C21H25N3O3S/c22-20(26)18(13-15-7-2-1-3-8-15)23-21(27)19-11-4-5-12-24(19)28-17-10-6-9-16(25)14-17/h1-3,6-10,14,18-19,25H,4-5,11-13H2,(H2,22,26)(H,23,27)/t18-,19-/m0/s1 |
| InChIKey | GTJKIKQCQSZFCS-OALUTQOASA-N |
| XLogP | 2.47 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|