C19H30NO5P — CID 67565926
3-[(1R)-1-[[(2R)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid (PubChem CID 67565926) has the molecular formula C19H30NO5P and a molecular weight of 383.43 g/mol. Its IUPAC name is 3-[(1R)-1-[[(2R)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid.
| Compound Name | 3-[(1R)-1-[[(2R)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 67565926 |
| Molecular Formula | C19H30NO5P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[(1R)-1-[[(2R)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
| SMILES | C[C@@H](NC[C@@H](O)CP(=O)(O)CC1CCCCC1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H30NO5P/c1-14(16-8-5-9-17(10-16)19(22)23)20-11-18(21)13-26(24,25)12-15-6-3-2-4-7-15/h5,8-10,14-15,18,20-21H,2-4,6-7,11-13H2,1H3,(H,22,23)(H,24,25)/t14-,18-/m1/s1 |
| InChIKey | JCFULPDIJOVUHP-RDTXWAMCSA-N |
| XLogP | 3.25 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|