C20H30N3O4P — CID 67566559
cyclohexylmethyl-[(2R)-2-hydroxy-3-[1-[3-(1,2,4-oxadiazol-5-yl)phenyl]ethylamino]propyl]phosphinic acid (PubChem CID 67566559) has the molecular formula C20H30N3O4P and a molecular weight of 407.45 g/mol. Its IUPAC name is cyclohexylmethyl-[(2R)-2-hydroxy-3-[1-[3-(1,2,4-oxadiazol-5-yl)phenyl]ethylamino]propyl]phosphinic acid.
| Compound Name | cyclohexylmethyl-[(2R)-2-hydroxy-3-[1-[3-(1,2,4-oxadiazol-5-yl)phenyl]ethylamino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 67566559 |
| Molecular Formula | C20H30N3O4P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | cyclohexylmethyl-[(2R)-2-hydroxy-3-[1-[3-(1,2,4-oxadiazol-5-yl)phenyl]ethylamino]propyl]phosphinic acid |
| SMILES | CC(NC[C@@H](O)CP(=O)(O)CC1CCCCC1)c1cccc(-c2ncno2)c1 |
| InChI | InChI=1S/C20H30N3O4P/c1-15(17-8-5-9-18(10-17)20-22-14-23-27-20)21-11-19(24)13-28(25,26)12-16-6-3-2-4-7-16/h5,8-10,14-16,19,21,24H,2-4,6-7,11-13H2,1H3,(H,25,26)/t15?,19-/m1/s1 |
| InChIKey | VHPMYVWSZOWHQY-XCWJXAQQSA-N |
| XLogP | 3.60 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|