C20H34NO5P — CID 67741808
cyclohexylmethyl-[(2R)-3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid (PubChem CID 67741808) has the molecular formula C20H34NO5P and a molecular weight of 399.47 g/mol. Its IUPAC name is cyclohexylmethyl-[(2R)-3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid.
| Compound Name | cyclohexylmethyl-[(2R)-3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid |
|---|---|
| PubChem CID | 67741808 |
| Molecular Formula | C20H34NO5P |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | cyclohexylmethyl-[(2R)-3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid |
| SMILES | COc1ccc(OC)c(C(C)NC[C@@H](O)CP(=O)(O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C20H34NO5P/c1-15(19-11-18(25-2)9-10-20(19)26-3)21-12-17(22)14-27(23,24)13-16-7-5-4-6-8-16/h9-11,15-17,21-22H,4-8,12-14H2,1-3H3,(H,23,24)/t15?,17-/m1/s1 |
| InChIKey | PQHDVXOODGTCAK-OMOCHNIRSA-N |
| XLogP | 3.57 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|