C20H28NO5P — CID 18981790
benzyl-[3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid (PubChem CID 18981790) has the molecular formula C20H28NO5P and a molecular weight of 393.42 g/mol. Its IUPAC name is benzyl-[3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid.
| Compound Name | benzyl-[3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid |
|---|---|
| PubChem CID | 18981790 |
| Molecular Formula | C20H28NO5P |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | benzyl-[3-[1-(2,5-dimethoxyphenyl)ethylamino]-2-hydroxypropyl]phosphinic acid |
| SMILES | COc1ccc(OC)c(C(C)NCC(O)CP(=O)(O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H28NO5P/c1-15(19-11-18(25-2)9-10-20(19)26-3)21-12-17(22)14-27(23,24)13-16-7-5-4-6-8-16/h4-11,15,17,21-22H,12-14H2,1-3H3,(H,23,24) |
| InChIKey | NAOLGPMUMLJCMF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|