C19H24NO5P — CID 18653949
4-[1-[[(2S)-3-[benzyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid (PubChem CID 18653949) has the molecular formula C19H24NO5P and a molecular weight of 377.38 g/mol. Its IUPAC name is 4-[1-[[(2S)-3-[benzyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[(2S)-3-[benzyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 18653949 |
| Molecular Formula | C19H24NO5P |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-[1-[[(2S)-3-[benzyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC[C@H](O)CP(=O)(O)Cc1ccccc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H24NO5P/c1-14(16-7-9-17(10-8-16)19(22)23)20-11-18(21)13-26(24,25)12-15-5-3-2-4-6-15/h2-10,14,18,20-21H,11-13H2,1H3,(H,22,23)(H,24,25)/t14?,18-/m0/s1 |
| InChIKey | CHARPESOQWZLSS-IBYPIGCZSA-N |
| XLogP | 2.87 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|