C23H34NO6P — CID 67741843
1-[benzyl(ethoxy)phosphoryl]-3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propan-2-ol (PubChem CID 67741843) has the molecular formula C23H34NO6P and a molecular weight of 451.50 g/mol. Its IUPAC name is 1-[benzyl(ethoxy)phosphoryl]-3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propan-2-ol.
| Compound Name | 1-[benzyl(ethoxy)phosphoryl]-3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 67741843 |
| Molecular Formula | C23H34NO6P |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 1-[benzyl(ethoxy)phosphoryl]-3-[1-(3,4,5-trimethoxyphenyl)ethylamino]propan-2-ol |
| SMILES | CCOP(=O)(Cc1ccccc1)CC(O)CNC(C)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H34NO6P/c1-6-30-31(26,15-18-10-8-7-9-11-18)16-20(25)14-24-17(2)19-12-21(27-3)23(29-5)22(13-19)28-4/h7-13,17,20,24-25H,6,14-16H2,1-5H3 |
| InChIKey | FUGZIJOFMQVCBT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|