C18H23Cl2INO3P — CID 67741771
benzyl-[(2S)-3-[1-(3-chloro-4-iodophenyl)ethylamino]-2-hydroxypropyl]phosphinic acid;hydrochloride (PubChem CID 67741771) has the molecular formula C18H23Cl2INO3P and a molecular weight of 530.17 g/mol. Its IUPAC name is benzyl-[(2S)-3-[1-(3-chloro-4-iodophenyl)ethylamino]-2-hydroxypropyl]phosphinic acid;hydrochloride.
| Compound Name | benzyl-[(2S)-3-[1-(3-chloro-4-iodophenyl)ethylamino]-2-hydroxypropyl]phosphinic acid;hydrochloride |
|---|---|
| PubChem CID | 67741771 |
| Molecular Formula | C18H23Cl2INO3P |
| Molecular Weight | 530.17 g/mol |
| Exact Mass | 528.98 |
| IUPAC Name | benzyl-[(2S)-3-[1-(3-chloro-4-iodophenyl)ethylamino]-2-hydroxypropyl]phosphinic acid;hydrochloride |
| SMILES | CC(NC[C@H](O)CP(=O)(O)Cc1ccccc1)c1ccc(I)c(Cl)c1.Cl |
| InChI | InChI=1S/C18H22ClINO3P.ClH/c1-13(15-7-8-18(20)17(19)9-15)21-10-16(22)12-25(23,24)11-14-5-3-2-4-6-14;/h2-9,13,16,21-22H,10-12H2,1H3,(H,23,24);1H/t13?,16-;/m0./s1 |
| InChIKey | AVZPJFPCXVEVPY-GPPWNDLUSA-N |
| XLogP | 4.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.17 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|