C18H22Cl2NO4P — CID 18658110
benzyl-[(2S)-3-[[1-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]-2-hydroxypropyl]phosphinic acid (PubChem CID 18658110) has the molecular formula C18H22Cl2NO4P and a molecular weight of 418.26 g/mol. Its IUPAC name is benzyl-[(2S)-3-[[1-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]-2-hydroxypropyl]phosphinic acid.
| Compound Name | benzyl-[(2S)-3-[[1-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]-2-hydroxypropyl]phosphinic acid |
|---|---|
| PubChem CID | 18658110 |
| Molecular Formula | C18H22Cl2NO4P |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | benzyl-[(2S)-3-[[1-(3,4-dichlorophenyl)-2-hydroxyethyl]amino]-2-hydroxypropyl]phosphinic acid |
| SMILES | O=P(O)(Cc1ccccc1)C[C@@H](O)CNC(CO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2NO4P/c19-16-7-6-14(8-17(16)20)18(10-22)21-9-15(23)12-26(24,25)11-13-4-2-1-3-5-13/h1-8,15,18,21-23H,9-12H2,(H,24,25)/t15-,18?/m0/s1 |
| InChIKey | VJTCABFDIJLBHR-BUSXIPJBSA-N |
| XLogP | 3.45 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|