C17H20Cl2NO3P — CID 19430123
(4-chlorophenyl)methyl-[3-[(4-chlorophenyl)methylamino]-2-hydroxypropyl]phosphinic acid (PubChem CID 19430123) has the molecular formula C17H20Cl2NO3P and a molecular weight of 388.23 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-[3-[(4-chlorophenyl)methylamino]-2-hydroxypropyl]phosphinic acid.
| Compound Name | (4-chlorophenyl)methyl-[3-[(4-chlorophenyl)methylamino]-2-hydroxypropyl]phosphinic acid |
|---|---|
| PubChem CID | 19430123 |
| Molecular Formula | C17H20Cl2NO3P |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (4-chlorophenyl)methyl-[3-[(4-chlorophenyl)methylamino]-2-hydroxypropyl]phosphinic acid |
| SMILES | O=P(O)(Cc1ccc(Cl)cc1)CC(O)CNCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20Cl2NO3P/c18-15-5-1-13(2-6-15)9-20-10-17(21)12-24(22,23)11-14-3-7-16(19)8-4-14/h1-8,17,20-21H,9-12H2,(H,22,23) |
| InChIKey | MLEZXJMWOIHWDM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|