C19H25ClNO3P — CID 19430085
benzyl-[3-[2-(4-chlorophenyl)propan-2-ylamino]-2-hydroxypropyl]phosphinic acid (PubChem CID 19430085) has the molecular formula C19H25ClNO3P and a molecular weight of 381.84 g/mol. Its IUPAC name is benzyl-[3-[2-(4-chlorophenyl)propan-2-ylamino]-2-hydroxypropyl]phosphinic acid.
| Compound Name | benzyl-[3-[2-(4-chlorophenyl)propan-2-ylamino]-2-hydroxypropyl]phosphinic acid |
|---|---|
| PubChem CID | 19430085 |
| Molecular Formula | C19H25ClNO3P |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | benzyl-[3-[2-(4-chlorophenyl)propan-2-ylamino]-2-hydroxypropyl]phosphinic acid |
| SMILES | CC(C)(NCC(O)CP(=O)(O)Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClNO3P/c1-19(2,16-8-10-17(20)11-9-16)21-12-18(22)14-25(23,24)13-15-6-4-3-5-7-15/h3-11,18,21-22H,12-14H2,1-2H3,(H,23,24) |
| InChIKey | GJTMIYHQMPMTGW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|