C18H28Cl2NO3P — CID 67682362
cyclohexylmethyl-[(2R)-3-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]phosphinic acid (PubChem CID 67682362) has the molecular formula C18H28Cl2NO3P and a molecular weight of 408.31 g/mol. Its IUPAC name is cyclohexylmethyl-[(2R)-3-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]phosphinic acid.
| Compound Name | cyclohexylmethyl-[(2R)-3-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]phosphinic acid |
|---|---|
| PubChem CID | 67682362 |
| Molecular Formula | C18H28Cl2NO3P |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | cyclohexylmethyl-[(2R)-3-[[(1R)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]phosphinic acid |
| SMILES | C[C@@H](NC[C@@H](O)CP(=O)(O)CC1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H28Cl2NO3P/c1-13(15-7-8-17(19)18(20)9-15)21-10-16(22)12-25(23,24)11-14-5-3-2-4-6-14/h7-9,13-14,16,21-22H,2-6,10-12H2,1H3,(H,23,24)/t13-,16-/m1/s1 |
| InChIKey | JGGVBBYJRQOPPA-CZUORRHYSA-N |
| XLogP | 4.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|