C20H25N4O4P — CID 67566538
[(2S)-3-[1-[3-(3-amino-1,2,4-oxadiazol-5-yl)phenyl]ethylamino]-2-hydroxypropyl]-benzylphosphinic acid (PubChem CID 67566538) has the molecular formula C20H25N4O4P and a molecular weight of 416.42 g/mol. Its IUPAC name is [(2S)-3-[1-[3-(3-amino-1,2,4-oxadiazol-5-yl)phenyl]ethylamino]-2-hydroxypropyl]-benzylphosphinic acid.
| Compound Name | [(2S)-3-[1-[3-(3-amino-1,2,4-oxadiazol-5-yl)phenyl]ethylamino]-2-hydroxypropyl]-benzylphosphinic acid |
|---|---|
| PubChem CID | 67566538 |
| Molecular Formula | C20H25N4O4P |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [(2S)-3-[1-[3-(3-amino-1,2,4-oxadiazol-5-yl)phenyl]ethylamino]-2-hydroxypropyl]-benzylphosphinic acid |
| SMILES | CC(NC[C@H](O)CP(=O)(O)Cc1ccccc1)c1cccc(-c2nc(N)no2)c1 |
| InChI | InChI=1S/C20H25N4O4P/c1-14(16-8-5-9-17(10-16)19-23-20(21)24-28-19)22-11-18(25)13-29(26,27)12-15-6-3-2-4-7-15/h2-10,14,18,22,25H,11-13H2,1H3,(H2,21,24)(H,26,27)/t14?,18-/m0/s1 |
| InChIKey | MGHKDBFBLTWOKG-IBYPIGCZSA-N |
| XLogP | 2.80 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|