C13H21NO4 — CID 61172770
(2S)-3-[1-(3,4-dimethoxyphenyl)ethylamino]propane-1,2-diol (PubChem CID 61172770) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (2S)-3-[1-(3,4-dimethoxyphenyl)ethylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[1-(3,4-dimethoxyphenyl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 61172770 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (2S)-3-[1-(3,4-dimethoxyphenyl)ethylamino]propane-1,2-diol |
| SMILES | COc1ccc(C(C)NC[C@H](O)CO)cc1OC |
| InChI | InChI=1S/C13H21NO4/c1-9(14-7-11(16)8-15)10-4-5-12(17-2)13(6-10)18-3/h4-6,9,11,14-16H,7-8H2,1-3H3/t9?,11-/m0/s1 |
| InChIKey | FZFICYDLTBYIFF-UMJHXOGRSA-N |
| XLogP | 0.71 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |