C11H16INO2 — CID 66175909
3-[1-(4-iodophenyl)ethylamino]propane-1,2-diol (PubChem CID 66175909) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 3-[1-(4-iodophenyl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[1-(4-iodophenyl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66175909 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 3-[1-(4-iodophenyl)ethylamino]propane-1,2-diol |
| SMILES | CC(NCC(O)CO)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H16INO2/c1-8(13-6-11(15)7-14)9-2-4-10(12)5-3-9/h2-5,8,11,13-15H,6-7H2,1H3 |
| InChIKey | AIALVOCWUWVFAP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|