C10H11F3IN — CID 43755062
2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]ethanamine (PubChem CID 43755062) has the molecular formula C10H11F3IN and a molecular weight of 329.10 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 43755062 |
| Molecular Formula | C10H11F3IN |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(4-iodophenyl)ethyl]ethanamine |
| SMILES | CC(NCC(F)(F)F)c1ccc(I)cc1 |
| InChI | InChI=1S/C10H11F3IN/c1-7(15-6-10(11,12)13)8-2-4-9(14)5-3-8/h2-5,7,15H,6H2,1H3 |
| InChIKey | FDQVMXGKDJSESD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|