C11H13BrF3N — CID 81359086
N-[(1S)-1-(4-bromophenyl)ethyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 81359086) has the molecular formula C11H13BrF3N and a molecular weight of 296.13 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 81359086 |
| Molecular Formula | C11H13BrF3N |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | C[C@H](NCCC(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrF3N/c1-8(16-7-6-11(13,14)15)9-2-4-10(12)5-3-9/h2-5,8,16H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | SXWPBJQTBGAVPE-QMMMGPOBSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |