C11H14F3NO2 — CID 107706521
5-[1-(3,3,3-trifluoropropylamino)ethyl]benzene-1,3-diol (PubChem CID 107706521) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 5-[1-(3,3,3-trifluoropropylamino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(3,3,3-trifluoropropylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107706521 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-[1-(3,3,3-trifluoropropylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NCCC(F)(F)F)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H14F3NO2/c1-7(15-3-2-11(12,13)14)8-4-9(16)6-10(17)5-8/h4-7,15-17H,2-3H2,1H3 |
| InChIKey | PXTILCBYWKRBAV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |