C11H17NO2S — CID 107706581
5-[1-(2-methylsulfanylethylamino)ethyl]benzene-1,3-diol (PubChem CID 107706581) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 5-[1-(2-methylsulfanylethylamino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(2-methylsulfanylethylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107706581 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 5-[1-(2-methylsulfanylethylamino)ethyl]benzene-1,3-diol |
| SMILES | CSCCNC(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H17NO2S/c1-8(12-3-4-15-2)9-5-10(13)7-11(14)6-9/h5-8,12-14H,3-4H2,1-2H3 |
| InChIKey | URXUTUPDYZGIOI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|