C17H28NO7P — CID 18653955
3-[(1R)-1-[[(2S)-3-[diethoxymethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid (PubChem CID 18653955) has the molecular formula C17H28NO7P and a molecular weight of 389.39 g/mol. Its IUPAC name is 3-[(1R)-1-[[(2S)-3-[diethoxymethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid.
| Compound Name | 3-[(1R)-1-[[(2S)-3-[diethoxymethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 18653955 |
| Molecular Formula | C17H28NO7P |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-[(1R)-1-[[(2S)-3-[diethoxymethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
| SMILES | CCOC(OCC)P(=O)(O)C[C@@H](O)CN[C@H](C)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H28NO7P/c1-4-24-17(25-5-2)26(22,23)11-15(19)10-18-12(3)13-7-6-8-14(9-13)16(20)21/h6-9,12,15,17-19H,4-5,10-11H2,1-3H3,(H,20,21)(H,22,23)/t12-,15+/m1/s1 |
| InChIKey | FJZBZSNXVRDXCV-DOMZBBRYSA-N |
| XLogP | 2.02 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|