C24H31IN5O7P — CID 59903430
3-[(1R)-1-[[(2S)-3-[5-[(4-azido-2-hydroxy-3-(125I)iodobenzoyl)amino]pentyl-hydroxyphosphoryl]-2-hydroxypropyl]amino]ethyl](125I)benzoic acid (PubChem CID 59903430) has the molecular formula C24H31IN5O7P and a molecular weight of 657.42 g/mol. Its IUPAC name is 3-[(1R)-1-[[(2S)-3-[5-[(4-azido-2-hydroxy-3-(125I)iodobenzoyl)amino]pentyl-hydroxyphosphoryl]-2-hydroxypropyl]amino]ethyl](125I)benzoic acid.
| Compound Name | 3-[(1R)-1-[[(2S)-3-[5-[(4-azido-2-hydroxy-3-(125I)iodobenzoyl)amino]pentyl-hydroxyphosphoryl]-2-hydroxypropyl]amino]ethyl](125I)benzoic acid |
|---|---|
| PubChem CID | 59903430 |
| Molecular Formula | C24H31IN5O7P |
| Molecular Weight | 657.42 g/mol |
| Exact Mass | 657.10 |
| IUPAC Name | 3-[(1R)-1-[[(2S)-3-[5-[(4-azido-2-hydroxy-3-(125I)iodobenzoyl)amino]pentyl-hydroxyphosphoryl]-2-hydroxypropyl]amino]ethyl](125I)benzoic acid |
| SMILES | C[C@@H](NC[C@H](O)CP(=O)(O)CCCCCNC(=O)c1ccc(N=[N+]=[N-])c([125I])c1O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H31IN5O7P/c1-15(16-6-5-7-17(12-16)24(34)35)28-13-18(31)14-38(36,37)11-4-2-3-10-27-23(33)19-8-9-20(29-30-26)21(25)22(19)32/h5-9,12,15,18,28,31-32H,2-4,10-11,13-14H2,1H3,(H,27,33)(H,34,35)(H,36,37)/t15-,18+/m1/s1/i25-2 |
| InChIKey | YBWIBRTXOVHHRG-DQPKGEOYSA-N |
| XLogP | 4.52 |
| TPSA | 204.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|