C26H41N4O5P — CID 66595345
[(2S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid (PubChem CID 66595345) has the molecular formula C26H41N4O5P and a molecular weight of 520.61 g/mol. Its IUPAC name is [(2S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid.
| Compound Name | [(2S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
|---|---|
| PubChem CID | 66595345 |
| Molecular Formula | C26H41N4O5P |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [(2S)-3-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-2-hydroxypropyl]-(cyclohexylmethyl)phosphinic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)NC[C@H](O)CP(=O)(O)CC1CCCCC1 |
| InChI | InChI=1S/C26H41N4O5P/c1-17(2)24(30-25(32)22(27)12-19-13-28-23-11-7-6-10-21(19)23)26(33)29-14-20(31)16-36(34,35)15-18-8-4-3-5-9-18/h6-7,10-11,13,17-18,20,22,24,28,31H,3-5,8-9,12,14-16,27H2,1-2H3,(H,29,33)(H,30,32)(H,34,35)/t20-,22-,24-/m0/s1 |
| InChIKey | DWFJRYHQMMUKGN-SSPYTLHUSA-N |
| XLogP | 2.51 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|