C17H29ClNO3P — CID 68622113
1-amino-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propan-2-ol;hydrochloride (PubChem CID 68622113) has the molecular formula C17H29ClNO3P and a molecular weight of 361.85 g/mol. Its IUPAC name is 1-amino-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propan-2-ol;hydrochloride.
| Compound Name | 1-amino-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 68622113 |
| Molecular Formula | C17H29ClNO3P |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-amino-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propan-2-ol;hydrochloride |
| SMILES | Cl.NCC(O)CP(=O)(CC1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C17H28NO3P.ClH/c18-11-17(19)14-22(20,13-16-9-5-2-6-10-16)21-12-15-7-3-1-4-8-15;/h1,3-4,7-8,16-17,19H,2,5-6,9-14,18H2;1H |
| InChIKey | ISRGMCDVXFDUKH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|