C29H42NO5P — CID 154733801
N-cyclohexylcyclohexanamine;2-[phenylmethoxy(phenylmethoxymethyl)phosphoryl]acetic acid (PubChem CID 154733801) has the molecular formula C29H42NO5P and a molecular weight of 515.63 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-[phenylmethoxy(phenylmethoxymethyl)phosphoryl]acetic acid.
| Compound Name | N-cyclohexylcyclohexanamine;2-[phenylmethoxy(phenylmethoxymethyl)phosphoryl]acetic acid |
|---|---|
| PubChem CID | 154733801 |
| Molecular Formula | C29H42NO5P |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-[phenylmethoxy(phenylmethoxymethyl)phosphoryl]acetic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=C(O)CP(=O)(COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H19O5P.C12H23N/c18-17(19)13-23(20,22-12-16-9-5-2-6-10-16)14-21-11-15-7-3-1-4-8-15;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H,11-14H2,(H,18,19);11-13H,1-10H2 |
| InChIKey | MTZNLGNETWHBRW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|