C22H36NO4P — CID 143150530
tert-butyl N-[3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propyl]carbamate (PubChem CID 143150530) has the molecular formula C22H36NO4P and a molecular weight of 409.51 g/mol. Its IUPAC name is tert-butyl N-[3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propyl]carbamate |
|---|---|
| PubChem CID | 143150530 |
| Molecular Formula | C22H36NO4P |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | tert-butyl N-[3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCP(=O)(CC1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H36NO4P/c1-22(2,3)27-21(24)23-15-10-16-28(25,18-20-13-8-5-9-14-20)26-17-19-11-6-4-7-12-19/h4,6-7,11-12,20H,5,8-10,13-18H2,1-3H3,(H,23,24) |
| InChIKey | ZQMHMQQAKCTWOO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|