C22H36NO5P — CID 68622142
tert-butyl N-[(2R)-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]-2-hydroxypropyl]carbamate (PubChem CID 68622142) has the molecular formula C22H36NO5P and a molecular weight of 425.51 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 68622142 |
| Molecular Formula | C22H36NO5P |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl N-[(2R)-3-[cyclohexylmethyl(phenylmethoxy)phosphoryl]-2-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](O)CP(=O)(CC1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H36NO5P/c1-22(2,3)28-21(25)23-14-20(24)17-29(26,16-19-12-8-5-9-13-19)27-15-18-10-6-4-7-11-18/h4,6-7,10-11,19-20,24H,5,8-9,12-17H2,1-3H3,(H,23,25)/t20-,29?/m1/s1 |
| InChIKey | UMJDHPNCYZYTNY-CUXXENAFSA-N |
| XLogP | 4.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|