C24H33FNO6P — CID 118424356
tert-butyl N-[(2R)-3-bis(phenylmethoxy)phosphoryloxy-2-fluoro-3-methylbutyl]carbamate (PubChem CID 118424356) has the molecular formula C24H33FNO6P and a molecular weight of 481.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-bis(phenylmethoxy)phosphoryloxy-2-fluoro-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-bis(phenylmethoxy)phosphoryloxy-2-fluoro-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 118424356 |
| Molecular Formula | C24H33FNO6P |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | tert-butyl N-[(2R)-3-bis(phenylmethoxy)phosphoryloxy-2-fluoro-3-methylbutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](F)C(C)(C)OP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H33FNO6P/c1-23(2,3)31-22(27)26-16-21(25)24(4,5)32-33(28,29-17-19-12-8-6-9-13-19)30-18-20-14-10-7-11-15-20/h6-15,21H,16-18H2,1-5H3,(H,26,27)/t21-/m1/s1 |
| InChIKey | ZCURWLCATCZRGQ-OAQYLSRUSA-N |
| XLogP | 6.19 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|