C17H26NO8P — CID 25155240
[(2R)-1-dimethoxyphosphoryloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] benzoate (PubChem CID 25155240) has the molecular formula C17H26NO8P and a molecular weight of 403.37 g/mol. Its IUPAC name is [(2R)-1-dimethoxyphosphoryloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] benzoate.
| Compound Name | [(2R)-1-dimethoxyphosphoryloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] benzoate |
|---|---|
| PubChem CID | 25155240 |
| Molecular Formula | C17H26NO8P |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(2R)-1-dimethoxyphosphoryloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] benzoate |
| SMILES | COP(=O)(OC)OC[C@@H](CNC(=O)OC(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26NO8P/c1-17(2,3)26-16(20)18-11-14(12-24-27(21,22-4)23-5)25-15(19)13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | QDHZRJDDSGCQFW-CQSZACIVSA-N |
| XLogP | 3.15 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|