C22H25NO9 — CID 118343579
[1-benzoyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] 3,4,5-trihydroxybenzoate (PubChem CID 118343579) has the molecular formula C22H25NO9 and a molecular weight of 447.44 g/mol. Its IUPAC name is [1-benzoyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [1-benzoyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 118343579 |
| Molecular Formula | C22H25NO9 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [1-benzoyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] 3,4,5-trihydroxybenzoate |
| SMILES | CC(C)(C)OC(=O)NCC(COC(=O)c1ccccc1)OC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H25NO9/c1-22(2,3)32-21(29)23-11-15(12-30-19(27)13-7-5-4-6-8-13)31-20(28)14-9-16(24)18(26)17(25)10-14/h4-10,15,24-26H,11-12H2,1-3H3,(H,23,29) |
| InChIKey | KPCFNCBBRWTTCY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|