C32H26O20 — CID 91468933
[(2S,3R)-2,3,4-tris[(3,4,5-trihydroxybenzoyl)oxy]butyl] 3,4,5-trihydroxybenzoate (PubChem CID 91468933) has the molecular formula C32H26O20 and a molecular weight of 730.54 g/mol. Its IUPAC name is [(2S,3R)-2,3,4-tris[(3,4,5-trihydroxybenzoyl)oxy]butyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2S,3R)-2,3,4-tris[(3,4,5-trihydroxybenzoyl)oxy]butyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 91468933 |
| Molecular Formula | C32H26O20 |
| Molecular Weight | 730.54 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | [(2S,3R)-2,3,4-tris[(3,4,5-trihydroxybenzoyl)oxy]butyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC[C@H](OC(=O)c1cc(O)c(O)c(O)c1)[C@@H](COC(=O)c1cc(O)c(O)c(O)c1)OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C32H26O20/c33-15-1-11(2-16(34)25(15)41)29(45)49-9-23(51-31(47)13-5-19(37)27(43)20(38)6-13)24(52-32(48)14-7-21(39)28(44)22(40)8-14)10-50-30(46)12-3-17(35)26(42)18(36)4-12/h1-8,23-24,33-44H,9-10H2/t23-,24+ |
| InChIKey | KTNLGSLSBIUBKC-PSWAGMNNSA-N |
| XLogP | 1.62 |
| TPSA | 347.96 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|