C16H16O5 — CID 87719767
2-phenylpropyl 3,4,5-trihydroxybenzoate (PubChem CID 87719767) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-phenylpropyl 3,4,5-trihydroxybenzoate.
| Compound Name | 2-phenylpropyl 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 87719767 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-phenylpropyl 3,4,5-trihydroxybenzoate |
| SMILES | CC(COC(=O)c1cc(O)c(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C16H16O5/c1-10(11-5-3-2-4-6-11)9-21-16(20)12-7-13(17)15(19)14(18)8-12/h2-8,10,17-19H,9H2,1H3 |
| InChIKey | JGJYFADKAUAFFM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|