About 2-phenylpropyl 2-chloro-2-oxoacetate
2-phenylpropyl 2-chloro-2-oxoacetate (PubChem CID 57296608) has the molecular formula C11H11ClO3
and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-phenylpropyl 2-chloro-2-oxoacetate.
Molecular Properties
| Compound Name | 2-phenylpropyl 2-chloro-2-oxoacetate |
| PubChem CID | 57296608 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-phenylpropyl 2-chloro-2-oxoacetate |
| SMILES | CC(COC(=O)C(=O)Cl)c1ccccc1 |
| InChI | InChI=1S/C11H11ClO3/c1-8(7-15-11(14)10(12)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | QCAWUPOINDTKBO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropyl 2-chloro-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropyl 2-chloro-2-oxoacetate?
The IUPAC name of 2-phenylpropyl 2-chloro-2-oxoacetate (CID 57296608) is 2-phenylpropyl 2-chloro-2-oxoacetate.
What is the SMILES notation for 2-phenylpropyl 2-chloro-2-oxoacetate?
The canonical SMILES for 2-phenylpropyl 2-chloro-2-oxoacetate is CC(COC(=O)C(=O)Cl)c1ccccc1.
What is the InChIKey of 2-phenylpropyl 2-chloro-2-oxoacetate?
The InChIKey is QCAWUPOINDTKBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO3/c1-8(7-15-11(14)10(12)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What are the key properties of 2-phenylpropyl 2-chloro-2-oxoacetate?
2-phenylpropyl 2-chloro-2-oxoacetate has a molecular weight of 226.66 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropyl 2-chloro-2-oxoacetate is sourced from PubChem (CID 57296608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).