C33H28O21 — CID 56590393
[(2R)-3-hydroxy-2,4-bis[(3,4,5-trihydroxybenzoyl)oxy]-3-[(3,4,5-trihydroxybenzoyl)oxymethyl]butyl] 3,4,5-trihydroxybenzoate (PubChem CID 56590393) has the molecular formula C33H28O21 and a molecular weight of 760.57 g/mol. Its IUPAC name is [(2R)-3-hydroxy-2,4-bis[(3,4,5-trihydroxybenzoyl)oxy]-3-[(3,4,5-trihydroxybenzoyl)oxymethyl]butyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R)-3-hydroxy-2,4-bis[(3,4,5-trihydroxybenzoyl)oxy]-3-[(3,4,5-trihydroxybenzoyl)oxymethyl]butyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 56590393 |
| Molecular Formula | C33H28O21 |
| Molecular Weight | 760.57 g/mol |
| Exact Mass | 760.11 |
| IUPAC Name | [(2R)-3-hydroxy-2,4-bis[(3,4,5-trihydroxybenzoyl)oxy]-3-[(3,4,5-trihydroxybenzoyl)oxymethyl]butyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC[C@@H](OC(=O)c1cc(O)c(O)c(O)c1)C(O)(COC(=O)c1cc(O)c(O)c(O)c1)COC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C33H28O21/c34-16-1-12(2-17(35)25(16)42)29(46)51-9-24(54-32(49)15-7-22(40)28(45)23(41)8-15)33(50,10-52-30(47)13-3-18(36)26(43)19(37)4-13)11-53-31(48)14-5-20(38)27(44)21(39)6-14/h1-8,24,34-45,50H,9-11H2/t24-/m1/s1 |
| InChIKey | JJNUIPLIYVPQDJ-XMMPIXPASA-N |
| XLogP | 0.98 |
| TPSA | 368.19 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.57 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|