C27H24O18 — CID 162908466
[4-formyl-2,3-dihydroxy-4,5-bis[(3,4,5-trihydroxybenzoyl)oxy]pentyl] 3,4,5-trihydroxybenzoate (PubChem CID 162908466) has the molecular formula C27H24O18 and a molecular weight of 636.47 g/mol. Its IUPAC name is [4-formyl-2,3-dihydroxy-4,5-bis[(3,4,5-trihydroxybenzoyl)oxy]pentyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-formyl-2,3-dihydroxy-4,5-bis[(3,4,5-trihydroxybenzoyl)oxy]pentyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 162908466 |
| Molecular Formula | C27H24O18 |
| Molecular Weight | 636.47 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | [4-formyl-2,3-dihydroxy-4,5-bis[(3,4,5-trihydroxybenzoyl)oxy]pentyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=CC(COC(=O)c1cc(O)c(O)c(O)c1)(OC(=O)c1cc(O)c(O)c(O)c1)C(O)C(O)COC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C27H24O18/c28-8-27(45-26(42)12-5-17(33)22(38)18(34)6-12,9-44-25(41)11-3-15(31)21(37)16(32)4-11)23(39)19(35)7-43-24(40)10-1-13(29)20(36)14(30)2-10/h1-6,8,19,23,29-39H,7,9H2 |
| InChIKey | XIOBKZGXHBXTMP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 318.50 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.47 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|