C24H30O11 — CID 126547505
[3-methyl-3-[2-methyl-2-(3,4,5-trihydroxybenzoyl)oxypropoxy]pentyl] 3,4,5-trihydroxybenzoate (PubChem CID 126547505) has the molecular formula C24H30O11 and a molecular weight of 494.49 g/mol. Its IUPAC name is [3-methyl-3-[2-methyl-2-(3,4,5-trihydroxybenzoyl)oxypropoxy]pentyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3-methyl-3-[2-methyl-2-(3,4,5-trihydroxybenzoyl)oxypropoxy]pentyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 126547505 |
| Molecular Formula | C24H30O11 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [3-methyl-3-[2-methyl-2-(3,4,5-trihydroxybenzoyl)oxypropoxy]pentyl] 3,4,5-trihydroxybenzoate |
| SMILES | CCC(C)(CCOC(=O)c1cc(O)c(O)c(O)c1)OCC(C)(C)OC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C24H30O11/c1-5-24(4,6-7-33-21(31)13-8-15(25)19(29)16(26)9-13)34-12-23(2,3)35-22(32)14-10-17(27)20(30)18(28)11-14/h8-11,25-30H,5-7,12H2,1-4H3 |
| InChIKey | XBKDXJBQOLUCIK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|