C27H28O15 — CID 166464395
[2-(formyloxymethyl)-2-methyl-3-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate;5-methylbenzene-1,2,3-triol (PubChem CID 166464395) has the molecular formula C27H28O15 and a molecular weight of 592.51 g/mol. Its IUPAC name is [2-(formyloxymethyl)-2-methyl-3-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate;5-methylbenzene-1,2,3-triol.
| Compound Name | [2-(formyloxymethyl)-2-methyl-3-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate;5-methylbenzene-1,2,3-triol |
|---|---|
| PubChem CID | 166464395 |
| Molecular Formula | C27H28O15 |
| Molecular Weight | 592.51 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | [2-(formyloxymethyl)-2-methyl-3-(3,4,5-trihydroxybenzoyl)oxypropyl] 3,4,5-trihydroxybenzoate;5-methylbenzene-1,2,3-triol |
| SMILES | CC(COC=O)(COC(=O)c1cc(O)c(O)c(O)c1)COC(=O)c1cc(O)c(O)c(O)c1.Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C20H20O12.C7H8O3/c1-20(6-30-9-21,7-31-18(28)10-2-12(22)16(26)13(23)3-10)8-32-19(29)11-4-14(24)17(27)15(25)5-11;1-4-2-5(8)7(10)6(9)3-4/h2-5,9,22-27H,6-8H2,1H3;2-3,8-10H,1H3 |
| InChIKey | BXZLPGWVGSLLBX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 260.97 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|