C21H22O14 — CID 173495347
[(Z)-3,4,5-trihydroxy-2-methoxy-6-(3,4,5-trihydroxybenzoyl)oxyhex-4-enyl] 3,4,5-trihydroxybenzoate (PubChem CID 173495347) has the molecular formula C21H22O14 and a molecular weight of 498.39 g/mol. Its IUPAC name is [(Z)-3,4,5-trihydroxy-2-methoxy-6-(3,4,5-trihydroxybenzoyl)oxyhex-4-enyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(Z)-3,4,5-trihydroxy-2-methoxy-6-(3,4,5-trihydroxybenzoyl)oxyhex-4-enyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 173495347 |
| Molecular Formula | C21H22O14 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | [(Z)-3,4,5-trihydroxy-2-methoxy-6-(3,4,5-trihydroxybenzoyl)oxyhex-4-enyl] 3,4,5-trihydroxybenzoate |
| SMILES | COC(COC(=O)c1cc(O)c(O)c(O)c1)C(O)/C(O)=C(/O)COC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C21H22O14/c1-33-15(7-35-21(32)9-4-12(24)17(28)13(25)5-9)19(30)18(29)14(26)6-34-20(31)8-2-10(22)16(27)11(23)3-8/h2-5,15,19,22-30H,6-7H2,1H3/b18-14- |
| InChIKey | QVXRGSCPGXGTTR-JXAWBTAJSA-N |
| XLogP | 0.64 |
| TPSA | 243.90 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|