C19H30BrN2O6P — CID 67707242
tert-butyl N-[[[bromo-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-phenylmethoxyphosphoryl]methyl]carbamate (PubChem CID 67707242) has the molecular formula C19H30BrN2O6P and a molecular weight of 493.34 g/mol. Its IUPAC name is tert-butyl N-[[[bromo-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-phenylmethoxyphosphoryl]methyl]carbamate.
| Compound Name | tert-butyl N-[[[bromo-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-phenylmethoxyphosphoryl]methyl]carbamate |
|---|---|
| PubChem CID | 67707242 |
| Molecular Formula | C19H30BrN2O6P |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | tert-butyl N-[[[bromo-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-phenylmethoxyphosphoryl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCP(=O)(OCc1ccccc1)C(Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30BrN2O6P/c1-18(2,3)27-16(23)21-13-29(25,26-12-14-10-8-7-9-11-14)15(20)22-17(24)28-19(4,5)6/h7-11,15H,12-13H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | KTOPQHZIYCJNPQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|