C18H26NO6P — CID 70426751
2-[[2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-hydroxyphosphoryl]acetic acid (PubChem CID 70426751) has the molecular formula C18H26NO6P and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-[[2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-hydroxyphosphoryl]acetic acid.
| Compound Name | 2-[[2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-hydroxyphosphoryl]acetic acid |
|---|---|
| PubChem CID | 70426751 |
| Molecular Formula | C18H26NO6P |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-hydroxyphosphoryl]acetic acid |
| SMILES | O=C(O)CP(=O)(O)C(CC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26NO6P/c20-17(21)13-26(23,24)16(11-14-7-3-1-4-8-14)19-18(22)25-12-15-9-5-2-6-10-15/h2,5-6,9-10,14,16H,1,3-4,7-8,11-13H2,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | VZONFCHFAXOENG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|