C37H44N5O8P — CID 70045240
2-[[2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]ethyl]-hydroxyphosphoryl]acetic acid (PubChem CID 70045240) has the molecular formula C37H44N5O8P and a molecular weight of 717.76 g/mol. Its IUPAC name is 2-[[2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]ethyl]-hydroxyphosphoryl]acetic acid.
| Compound Name | 2-[[2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]ethyl]-hydroxyphosphoryl]acetic acid |
|---|---|
| PubChem CID | 70045240 |
| Molecular Formula | C37H44N5O8P |
| Molecular Weight | 717.76 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | 2-[[2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-[[3-naphthalen-1-yl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]ethyl]-hydroxyphosphoryl]acetic acid |
| SMILES | O=C(O)CP(=O)(O)C(CC1CCCCC1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)C(Cc1cccc2ccccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H44N5O8P/c43-34(44)23-51(48,49)33(18-25-10-3-1-4-11-25)42-36(46)32(20-29-21-38-24-39-29)40-35(45)31(41-37(47)50-22-26-12-5-2-6-13-26)19-28-16-9-15-27-14-7-8-17-30(27)28/h2,5-9,12-17,21,24-25,31-33H,1,3-4,10-11,18-20,22-23H2,(H,38,39)(H,40,45)(H,41,47)(H,42,46)(H,43,44)(H,48,49)/t31?,32-,33?/m0/s1 |
| InChIKey | BYWHTVDQUBQOFO-OMYKBPHGSA-N |
| XLogP | 4.90 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|