C28H43N4O5P — CID 70427047
[2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]-(4-methylpentyl)phosphinic acid (PubChem CID 70427047) has the molecular formula C28H43N4O5P and a molecular weight of 546.65 g/mol. Its IUPAC name is [2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]-(4-methylpentyl)phosphinic acid.
| Compound Name | [2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]-(4-methylpentyl)phosphinic acid |
|---|---|
| PubChem CID | 70427047 |
| Molecular Formula | C28H43N4O5P |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | [2-cyclohexyl-1-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]-(4-methylpentyl)phosphinic acid |
| SMILES | CC(C)CCCP(=O)(O)C(CC1CCCCC1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H43N4O5P/c1-21(2)10-9-15-38(35,36)26(16-22-11-5-3-6-12-22)32-27(33)25(17-24-18-29-20-30-24)31-28(34)37-19-23-13-7-4-8-14-23/h4,7-8,13-14,18,20-22,25-26H,3,5-6,9-12,15-17,19H2,1-2H3,(H,29,30)(H,31,34)(H,32,33)(H,35,36)/t25-,26?/m0/s1 |
| InChIKey | LFDKWGDASJAKIN-PMCHYTPCSA-N |
| XLogP | 5.37 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|