C24H38NO6P — CID 67913321
(5-cyclohexyl-2-methoxycarbonylpentyl)-[1-(phenylmethoxycarbonylamino)propyl]phosphinic acid (PubChem CID 67913321) has the molecular formula C24H38NO6P and a molecular weight of 467.54 g/mol. Its IUPAC name is (5-cyclohexyl-2-methoxycarbonylpentyl)-[1-(phenylmethoxycarbonylamino)propyl]phosphinic acid.
| Compound Name | (5-cyclohexyl-2-methoxycarbonylpentyl)-[1-(phenylmethoxycarbonylamino)propyl]phosphinic acid |
|---|---|
| PubChem CID | 67913321 |
| Molecular Formula | C24H38NO6P |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (5-cyclohexyl-2-methoxycarbonylpentyl)-[1-(phenylmethoxycarbonylamino)propyl]phosphinic acid |
| SMILES | CCC(NC(=O)OCc1ccccc1)P(=O)(O)CC(CCCC1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C24H38NO6P/c1-3-22(25-24(27)31-17-20-13-8-5-9-14-20)32(28,29)18-21(23(26)30-2)16-10-15-19-11-6-4-7-12-19/h5,8-9,13-14,19,21-22H,3-4,6-7,10-12,15-18H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | DEDHBSOQYYVWOO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|