C24H32NO6P — CID 154261371
methyl 2-[[methoxy-[1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-5-phenylpentanoate (PubChem CID 154261371) has the molecular formula C24H32NO6P and a molecular weight of 461.50 g/mol. Its IUPAC name is methyl 2-[[methoxy-[1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-5-phenylpentanoate.
| Compound Name | methyl 2-[[methoxy-[1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 154261371 |
| Molecular Formula | C24H32NO6P |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | methyl 2-[[methoxy-[1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-5-phenylpentanoate |
| SMILES | COC(=O)C(CCCc1ccccc1)CP(=O)(OC)C(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H32NO6P/c1-19(25-24(27)31-17-21-13-8-5-9-14-21)32(28,30-3)18-22(23(26)29-2)16-10-15-20-11-6-4-7-12-20/h4-9,11-14,19,22H,10,15-18H2,1-3H3,(H,25,27) |
| InChIKey | ICMGHLVUEYUDMY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|