C22H36NO6P — CID 19878106
methyl 2-[[butyl(methoxy)phosphoryl]-(phenylmethoxycarbonylamino)methyl]-3-methylhexanoate (PubChem CID 19878106) has the molecular formula C22H36NO6P and a molecular weight of 441.51 g/mol. Its IUPAC name is methyl 2-[[butyl(methoxy)phosphoryl]-(phenylmethoxycarbonylamino)methyl]-3-methylhexanoate.
| Compound Name | methyl 2-[[butyl(methoxy)phosphoryl]-(phenylmethoxycarbonylamino)methyl]-3-methylhexanoate |
|---|---|
| PubChem CID | 19878106 |
| Molecular Formula | C22H36NO6P |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | methyl 2-[[butyl(methoxy)phosphoryl]-(phenylmethoxycarbonylamino)methyl]-3-methylhexanoate |
| SMILES | CCCCP(=O)(OC)C(NC(=O)OCc1ccccc1)C(C(=O)OC)C(C)CCC |
| InChI | InChI=1S/C22H36NO6P/c1-6-8-15-30(26,28-5)20(19(21(24)27-4)17(3)12-7-2)23-22(25)29-16-18-13-10-9-11-14-18/h9-11,13-14,17,19-20H,6-8,12,15-16H2,1-5H3,(H,23,25) |
| InChIKey | VPCJRSPXMGYULS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|