C19H27NO3 — CID 70043914
benzyl (2S)-5-amino-2-(cyclohexylmethyl)-3-hydroxypent-4-enoate (PubChem CID 70043914) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is benzyl (2S)-5-amino-2-(cyclohexylmethyl)-3-hydroxypent-4-enoate.
| Compound Name | benzyl (2S)-5-amino-2-(cyclohexylmethyl)-3-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 70043914 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | benzyl (2S)-5-amino-2-(cyclohexylmethyl)-3-hydroxypent-4-enoate |
| SMILES | NC=CC(O)[C@H](CC1CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c20-12-11-18(21)17(13-15-7-3-1-4-8-15)19(22)23-14-16-9-5-2-6-10-16/h2,5-6,9-12,15,17-18,21H,1,3-4,7-8,13-14,20H2/t17-,18?/m0/s1 |
| InChIKey | MNKKIFHQBMKEIY-ZENAZSQFSA-N |
| XLogP | 3.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |