C17H23NO3 — CID 175973508
benzyl (3S)-3-amino-4-cyclohexyl-2-oxobutanoate (PubChem CID 175973508) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is benzyl (3S)-3-amino-4-cyclohexyl-2-oxobutanoate.
| Compound Name | benzyl (3S)-3-amino-4-cyclohexyl-2-oxobutanoate |
|---|---|
| PubChem CID | 175973508 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | benzyl (3S)-3-amino-4-cyclohexyl-2-oxobutanoate |
| SMILES | N[C@@H](CC1CCCCC1)C(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c18-15(11-13-7-3-1-4-8-13)16(19)17(20)21-12-14-9-5-2-6-10-14/h2,5-6,9-10,13,15H,1,3-4,7-8,11-12,18H2/t15-/m0/s1 |
| InChIKey | ZESNUPRZYZTYDZ-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|