C21H32N2O3S — CID 54554752
benzyl (2S)-2-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 54554752) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 54554752 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CC1CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O3S/c1-27-13-12-19(21(25)26-15-17-10-6-3-7-11-17)23-20(24)18(22)14-16-8-4-2-5-9-16/h3,6-7,10-11,16,18-19H,2,4-5,8-9,12-15,22H2,1H3,(H,23,24)/t18-,19-/m0/s1 |
| InChIKey | ZMJTUMFSWJFSCD-OALUTQOASA-N |
| XLogP | 3.27 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |